C16H23F2NO3S — CID 86992926
2-(3,4-difluorophenyl)sulfonyl-N,N-bis(2-methylpropyl)acetamide (PubChem CID 86992926) has the molecular formula C16H23F2NO3S and a molecular weight of 347.43 g/mol. Its IUPAC name is 2-(3,4-difluorophenyl)sulfonyl-N,N-bis(2-methylpropyl)acetamide.
| Compound Name | 2-(3,4-difluorophenyl)sulfonyl-N,N-bis(2-methylpropyl)acetamide |
|---|---|
| PubChem CID | 86992926 |
| Molecular Formula | C16H23F2NO3S |
| Molecular Weight | 347.43 g/mol |
| Exact Mass | 347.14 |
| IUPAC Name | 2-(3,4-difluorophenyl)sulfonyl-N,N-bis(2-methylpropyl)acetamide |
| SMILES | CC(C)CN(CC(C)C)C(=O)CS(=O)(=O)c1ccc(F)c(F)c1 |
| InChI | InChI=1S/C16H23F2NO3S/c1-11(2)8-19(9-12(3)4)16(20)10-23(21,22)13-5-6-14(17)15(18)7-13/h5-7,11-12H,8-10H2,1-4H3 |
| InChIKey | HTTVZDHULNJOIV-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.43 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |