C10H13F2NO3S — CID 82715795
3,4-difluoro-N-(2-methylpropoxy)benzenesulfonamide (PubChem CID 82715795) has the molecular formula C10H13F2NO3S and a molecular weight of 265.28 g/mol. Its IUPAC name is 3,4-difluoro-N-(2-methylpropoxy)benzenesulfonamide.
| Compound Name | 3,4-difluoro-N-(2-methylpropoxy)benzenesulfonamide |
|---|---|
| PubChem CID | 82715795 |
| Molecular Formula | C10H13F2NO3S |
| Molecular Weight | 265.28 g/mol |
| Exact Mass | 265.06 |
| IUPAC Name | 3,4-difluoro-N-(2-methylpropoxy)benzenesulfonamide |
| SMILES | CC(C)CONS(=O)(=O)c1ccc(F)c(F)c1 |
| InChI | InChI=1S/C10H13F2NO3S/c1-7(2)6-16-13-17(14,15)8-3-4-9(11)10(12)5-8/h3-5,7,13H,6H2,1-2H3 |
| InChIKey | MAGYJKXRKYKYEF-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.28 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|