C11H16ClNO5S2 — CID 82715577
2-chloro-N-(2-methylpropoxy)-5-methylsulfonylbenzenesulfonamide (PubChem CID 82715577) has the molecular formula C11H16ClNO5S2 and a molecular weight of 341.84 g/mol. Its IUPAC name is 2-chloro-N-(2-methylpropoxy)-5-methylsulfonylbenzenesulfonamide.
| Compound Name | 2-chloro-N-(2-methylpropoxy)-5-methylsulfonylbenzenesulfonamide |
|---|---|
| PubChem CID | 82715577 |
| Molecular Formula | C11H16ClNO5S2 |
| Molecular Weight | 341.84 g/mol |
| Exact Mass | 341.02 |
| IUPAC Name | 2-chloro-N-(2-methylpropoxy)-5-methylsulfonylbenzenesulfonamide |
| SMILES | CC(C)CONS(=O)(=O)c1cc(S(C)(=O)=O)ccc1Cl |
| InChI | InChI=1S/C11H16ClNO5S2/c1-8(2)7-18-13-20(16,17)11-6-9(19(3,14)15)4-5-10(11)12/h4-6,8,13H,7H2,1-3H3 |
| InChIKey | ZRHGTAWUPCPJCL-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 89.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.84 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|