C10H15ClN2O4S2 — CID 62656822
2-chloro-N-[2-(methylamino)ethyl]-5-methylsulfonylbenzenesulfonamide (PubChem CID 62656822) has the molecular formula C10H15ClN2O4S2 and a molecular weight of 326.83 g/mol. Its IUPAC name is 2-chloro-N-[2-(methylamino)ethyl]-5-methylsulfonylbenzenesulfonamide.
| Compound Name | 2-chloro-N-[2-(methylamino)ethyl]-5-methylsulfonylbenzenesulfonamide |
|---|---|
| PubChem CID | 62656822 |
| Molecular Formula | C10H15ClN2O4S2 |
| Molecular Weight | 326.83 g/mol |
| Exact Mass | 326.02 |
| IUPAC Name | 2-chloro-N-[2-(methylamino)ethyl]-5-methylsulfonylbenzenesulfonamide |
| SMILES | CNCCNS(=O)(=O)c1cc(S(C)(=O)=O)ccc1Cl |
| InChI | InChI=1S/C10H15ClN2O4S2/c1-12-5-6-13-19(16,17)10-7-8(18(2,14)15)3-4-9(10)11/h3-4,7,12-13H,5-6H2,1-2H3 |
| InChIKey | RMGUPMXZHQICRG-UHFFFAOYSA-N |
| XLogP | 0.24 |
| TPSA | 92.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.83 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|