C15H16ClNO4S2 — CID 134043562
2-chloro-5-methylsulfonyl-N-(2-phenylethyl)benzenesulfonamide (PubChem CID 134043562) has the molecular formula C15H16ClNO4S2 and a molecular weight of 373.88 g/mol. Its IUPAC name is 2-chloro-5-methylsulfonyl-N-(2-phenylethyl)benzenesulfonamide.
| Compound Name | 2-chloro-5-methylsulfonyl-N-(2-phenylethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 134043562 |
| Molecular Formula | C15H16ClNO4S2 |
| Molecular Weight | 373.88 g/mol |
| Exact Mass | 373.02 |
| IUPAC Name | 2-chloro-5-methylsulfonyl-N-(2-phenylethyl)benzenesulfonamide |
| SMILES | CS(=O)(=O)c1ccc(Cl)c(S(=O)(=O)NCCc2ccccc2)c1 |
| InChI | InChI=1S/C15H16ClNO4S2/c1-22(18,19)13-7-8-14(16)15(11-13)23(20,21)17-10-9-12-5-3-2-4-6-12/h2-8,11,17H,9-10H2,1H3 |
| InChIKey | CUSBXFRMJXJPND-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 80.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.88 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |