C15H14Cl3NO2S — CID 19680947
2,4,5-trichloro-N-(3-phenylpropyl)benzenesulfonamide (PubChem CID 19680947) has the molecular formula C15H14Cl3NO2S and a molecular weight of 378.71 g/mol. Its IUPAC name is 2,4,5-trichloro-N-(3-phenylpropyl)benzenesulfonamide.
| Compound Name | 2,4,5-trichloro-N-(3-phenylpropyl)benzenesulfonamide |
|---|---|
| PubChem CID | 19680947 |
| Molecular Formula | C15H14Cl3NO2S |
| Molecular Weight | 378.71 g/mol |
| Exact Mass | 376.98 |
| IUPAC Name | 2,4,5-trichloro-N-(3-phenylpropyl)benzenesulfonamide |
| SMILES | O=S(=O)(NCCCc1ccccc1)c1cc(Cl)c(Cl)cc1Cl |
| InChI | InChI=1S/C15H14Cl3NO2S/c16-12-9-14(18)15(10-13(12)17)22(20,21)19-8-4-7-11-5-2-1-3-6-11/h1-3,5-6,9-10,19H,4,7-8H2 |
| InChIKey | AXXOASGOCIHMEP-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.71 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|