C14H11Cl4NO2S — CID 19680921
2,4,5-trichloro-N-[2-(3-chlorophenyl)ethyl]benzenesulfonamide (PubChem CID 19680921) has the molecular formula C14H11Cl4NO2S and a molecular weight of 399.13 g/mol. Its IUPAC name is 2,4,5-trichloro-N-[2-(3-chlorophenyl)ethyl]benzenesulfonamide.
| Compound Name | 2,4,5-trichloro-N-[2-(3-chlorophenyl)ethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 19680921 |
| Molecular Formula | C14H11Cl4NO2S |
| Molecular Weight | 399.13 g/mol |
| Exact Mass | 396.93 |
| IUPAC Name | 2,4,5-trichloro-N-[2-(3-chlorophenyl)ethyl]benzenesulfonamide |
| SMILES | O=S(=O)(NCCc1cccc(Cl)c1)c1cc(Cl)c(Cl)cc1Cl |
| InChI | InChI=1S/C14H11Cl4NO2S/c15-10-3-1-2-9(6-10)4-5-19-22(20,21)14-8-12(17)11(16)7-13(14)18/h1-3,6-8,19H,4-5H2 |
| InChIKey | RFLSNHMXDVKJJL-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.13 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|