C14H16ClNO2S — CID 173149770
N-[2-(3-chlorophenyl)ethyl]cyclohexa-1,5-diene-1-sulfonamide (PubChem CID 173149770) has the molecular formula C14H16ClNO2S and a molecular weight of 297.81 g/mol. Its IUPAC name is N-[2-(3-chlorophenyl)ethyl]cyclohexa-1,5-diene-1-sulfonamide.
| Compound Name | N-[2-(3-chlorophenyl)ethyl]cyclohexa-1,5-diene-1-sulfonamide |
|---|---|
| PubChem CID | 173149770 |
| Molecular Formula | C14H16ClNO2S |
| Molecular Weight | 297.81 g/mol |
| Exact Mass | 297.06 |
| IUPAC Name | N-[2-(3-chlorophenyl)ethyl]cyclohexa-1,5-diene-1-sulfonamide |
| SMILES | O=S(=O)(NCCc1cccc(Cl)c1)C1=CCCC=C1 |
| InChI | InChI=1S/C14H16ClNO2S/c15-13-6-4-5-12(11-13)9-10-16-19(17,18)14-7-2-1-3-8-14/h2,4-8,11,16H,1,3,9-10H2 |
| InChIKey | ZUCIXPIUQGDIGJ-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.81 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |