C13H19F2NO3S — CID 115476603
1-(3,4-difluorophenyl)sulfonyl-3-(2-methylpropylamino)propan-2-ol (PubChem CID 115476603) has the molecular formula C13H19F2NO3S and a molecular weight of 307.36 g/mol. Its IUPAC name is 1-(3,4-difluorophenyl)sulfonyl-3-(2-methylpropylamino)propan-2-ol.
| Compound Name | 1-(3,4-difluorophenyl)sulfonyl-3-(2-methylpropylamino)propan-2-ol |
|---|---|
| PubChem CID | 115476603 |
| Molecular Formula | C13H19F2NO3S |
| Molecular Weight | 307.36 g/mol |
| Exact Mass | 307.11 |
| IUPAC Name | 1-(3,4-difluorophenyl)sulfonyl-3-(2-methylpropylamino)propan-2-ol |
| SMILES | CC(C)CNCC(O)CS(=O)(=O)c1ccc(F)c(F)c1 |
| InChI | InChI=1S/C13H19F2NO3S/c1-9(2)6-16-7-10(17)8-20(18,19)11-3-4-12(14)13(15)5-11/h3-5,9-10,16-17H,6-8H2,1-2H3 |
| InChIKey | KWOFFDBKAYHBKW-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.36 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |