C13H20BrNO3S — CID 115476729
1-(3-bromophenyl)sulfonyl-3-(2-methylpropylamino)propan-2-ol (PubChem CID 115476729) has the molecular formula C13H20BrNO3S and a molecular weight of 350.28 g/mol. Its IUPAC name is 1-(3-bromophenyl)sulfonyl-3-(2-methylpropylamino)propan-2-ol.
| Compound Name | 1-(3-bromophenyl)sulfonyl-3-(2-methylpropylamino)propan-2-ol |
|---|---|
| PubChem CID | 115476729 |
| Molecular Formula | C13H20BrNO3S |
| Molecular Weight | 350.28 g/mol |
| Exact Mass | 349.03 |
| IUPAC Name | 1-(3-bromophenyl)sulfonyl-3-(2-methylpropylamino)propan-2-ol |
| SMILES | CC(C)CNCC(O)CS(=O)(=O)c1cccc(Br)c1 |
| InChI | InChI=1S/C13H20BrNO3S/c1-10(2)7-15-8-12(16)9-19(17,18)13-5-3-4-11(14)6-13/h3-6,10,12,15-16H,7-9H2,1-2H3 |
| InChIKey | ZSNHMXJZZPMFCE-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.28 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |