C12H18FNO3S — CID 115477152
1-(3-fluorophenyl)sulfonyl-3-(propan-2-ylamino)propan-2-ol (PubChem CID 115477152) has the molecular formula C12H18FNO3S and a molecular weight of 275.34 g/mol. Its IUPAC name is 1-(3-fluorophenyl)sulfonyl-3-(propan-2-ylamino)propan-2-ol.
| Compound Name | 1-(3-fluorophenyl)sulfonyl-3-(propan-2-ylamino)propan-2-ol |
|---|---|
| PubChem CID | 115477152 |
| Molecular Formula | C12H18FNO3S |
| Molecular Weight | 275.34 g/mol |
| Exact Mass | 275.10 |
| IUPAC Name | 1-(3-fluorophenyl)sulfonyl-3-(propan-2-ylamino)propan-2-ol |
| SMILES | CC(C)NCC(O)CS(=O)(=O)c1cccc(F)c1 |
| InChI | InChI=1S/C12H18FNO3S/c1-9(2)14-7-11(15)8-18(16,17)12-5-3-4-10(13)6-12/h3-6,9,11,14-15H,7-8H2,1-2H3 |
| InChIKey | SYNGCGOZSFPGQN-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.34 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |