C9H11FO4S — CID 111969337
3-(3-fluorophenyl)sulfonylpropane-1,2-diol (PubChem CID 111969337) has the molecular formula C9H11FO4S and a molecular weight of 234.25 g/mol. Its IUPAC name is 3-(3-fluorophenyl)sulfonylpropane-1,2-diol.
| Compound Name | 3-(3-fluorophenyl)sulfonylpropane-1,2-diol |
|---|---|
| PubChem CID | 111969337 |
| Molecular Formula | C9H11FO4S |
| Molecular Weight | 234.25 g/mol |
| Exact Mass | 234.04 |
| IUPAC Name | 3-(3-fluorophenyl)sulfonylpropane-1,2-diol |
| SMILES | O=S(=O)(CC(O)CO)c1cccc(F)c1 |
| InChI | InChI=1S/C9H11FO4S/c10-7-2-1-3-9(4-7)15(13,14)6-8(12)5-11/h1-4,8,11-12H,5-6H2 |
| InChIKey | CIAZALZESXUNEE-UHFFFAOYSA-N |
| XLogP | -0.05 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.25 |
| LogP ≤ 5 | -0.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |