C10H11F3O4S — CID 71977096
3-[3-(trifluoromethyl)phenyl]sulfonylpropane-1,2-diol (PubChem CID 71977096) has the molecular formula C10H11F3O4S and a molecular weight of 284.25 g/mol. Its IUPAC name is 3-[3-(trifluoromethyl)phenyl]sulfonylpropane-1,2-diol.
| Compound Name | 3-[3-(trifluoromethyl)phenyl]sulfonylpropane-1,2-diol |
|---|---|
| PubChem CID | 71977096 |
| Molecular Formula | C10H11F3O4S |
| Molecular Weight | 284.25 g/mol |
| Exact Mass | 284.03 |
| IUPAC Name | 3-[3-(trifluoromethyl)phenyl]sulfonylpropane-1,2-diol |
| SMILES | O=S(=O)(CC(O)CO)c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C10H11F3O4S/c11-10(12,13)7-2-1-3-9(4-7)18(16,17)6-8(15)5-14/h1-4,8,14-15H,5-6H2 |
| InChIKey | DMSVEYNWKLRINC-UHFFFAOYSA-N |
| XLogP | 0.83 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.25 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |