C13H18F3NO2S — CID 64646267
3,3-dimethyl-1-[3-(trifluoromethyl)phenyl]sulfonylbutan-2-amine (PubChem CID 64646267) has the molecular formula C13H18F3NO2S and a molecular weight of 309.35 g/mol. Its IUPAC name is 3,3-dimethyl-1-[3-(trifluoromethyl)phenyl]sulfonylbutan-2-amine.
| Compound Name | 3,3-dimethyl-1-[3-(trifluoromethyl)phenyl]sulfonylbutan-2-amine |
|---|---|
| PubChem CID | 64646267 |
| Molecular Formula | C13H18F3NO2S |
| Molecular Weight | 309.35 g/mol |
| Exact Mass | 309.10 |
| IUPAC Name | 3,3-dimethyl-1-[3-(trifluoromethyl)phenyl]sulfonylbutan-2-amine |
| SMILES | CC(C)(C)C(N)CS(=O)(=O)c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C13H18F3NO2S/c1-12(2,3)11(17)8-20(18,19)10-6-4-5-9(7-10)13(14,15)16/h4-7,11H,8,17H2,1-3H3 |
| InChIKey | GLXHQSKWLSYWGN-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 60.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.35 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |