C14H16F3NO4S — CID 1478659
1-[(2R)-2-hydroxy-3-[3-(trifluoromethyl)phenyl]sulfonylpropyl]pyrrolidin-2-one (PubChem CID 1478659) has the molecular formula C14H16F3NO4S and a molecular weight of 351.35 g/mol. Its IUPAC name is 1-[(2R)-2-hydroxy-3-[3-(trifluoromethyl)phenyl]sulfonylpropyl]pyrrolidin-2-one.
| Compound Name | 1-[(2R)-2-hydroxy-3-[3-(trifluoromethyl)phenyl]sulfonylpropyl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 1478659 |
| Molecular Formula | C14H16F3NO4S |
| Molecular Weight | 351.35 g/mol |
| Exact Mass | 351.08 |
| IUPAC Name | 1-[(2R)-2-hydroxy-3-[3-(trifluoromethyl)phenyl]sulfonylpropyl]pyrrolidin-2-one |
| SMILES | O=C1CCCN1C[C@@H](O)CS(=O)(=O)c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C14H16F3NO4S/c15-14(16,17)10-3-1-4-12(7-10)23(21,22)9-11(19)8-18-6-2-5-13(18)20/h1,3-4,7,11,19H,2,5-6,8-9H2/t11-/m1/s1 |
| InChIKey | MQNQOKNQXHGSNM-LLVKDONJSA-N |
| XLogP | 1.46 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.35 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |