C12H13F3O3S — CID 64643363
1-[3-(trifluoromethyl)phenyl]sulfonylpentan-2-one (PubChem CID 64643363) has the molecular formula C12H13F3O3S and a molecular weight of 294.29 g/mol. Its IUPAC name is 1-[3-(trifluoromethyl)phenyl]sulfonylpentan-2-one.
| Compound Name | 1-[3-(trifluoromethyl)phenyl]sulfonylpentan-2-one |
|---|---|
| PubChem CID | 64643363 |
| Molecular Formula | C12H13F3O3S |
| Molecular Weight | 294.29 g/mol |
| Exact Mass | 294.05 |
| IUPAC Name | 1-[3-(trifluoromethyl)phenyl]sulfonylpentan-2-one |
| SMILES | CCCC(=O)CS(=O)(=O)c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C12H13F3O3S/c1-2-4-10(16)8-19(17,18)11-6-3-5-9(7-11)12(13,14)15/h3,5-7H,2,4,8H2,1H3 |
| InChIKey | OMKZJKYFJIIAKI-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.29 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |