C15H26O4S — CID 158091842
1-[3-(2-hydroxypropan-2-yl)phenyl]sulfonylbutan-2-one;methane (PubChem CID 158091842) has the molecular formula C15H26O4S and a molecular weight of 302.44 g/mol. Its IUPAC name is 1-[3-(2-hydroxypropan-2-yl)phenyl]sulfonylbutan-2-one;methane.
| Compound Name | 1-[3-(2-hydroxypropan-2-yl)phenyl]sulfonylbutan-2-one;methane |
|---|---|
| PubChem CID | 158091842 |
| Molecular Formula | C15H26O4S |
| Molecular Weight | 302.44 g/mol |
| Exact Mass | 302.16 |
| IUPAC Name | 1-[3-(2-hydroxypropan-2-yl)phenyl]sulfonylbutan-2-one;methane |
| SMILES | C.C.CCC(=O)CS(=O)(=O)c1cccc(C(C)(C)O)c1 |
| InChI | InChI=1S/C13H18O4S.2CH4/c1-4-11(14)9-18(16,17)12-7-5-6-10(8-12)13(2,3)15;;/h5-8,15H,4,9H2,1-3H3;2*1H4 |
| InChIKey | FOEUEGFMRMLXOA-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 71.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.44 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |