C31H30O5S2 — CID 174469215
2,6-bis(benzenesulfonyl)-2,6-diphenylheptan-4-one (PubChem CID 174469215) has the molecular formula C31H30O5S2 and a molecular weight of 546.71 g/mol. Its IUPAC name is 2,6-bis(benzenesulfonyl)-2,6-diphenylheptan-4-one.
| Compound Name | 2,6-bis(benzenesulfonyl)-2,6-diphenylheptan-4-one |
|---|---|
| PubChem CID | 174469215 |
| Molecular Formula | C31H30O5S2 |
| Molecular Weight | 546.71 g/mol |
| Exact Mass | 546.15 |
| IUPAC Name | 2,6-bis(benzenesulfonyl)-2,6-diphenylheptan-4-one |
| SMILES | CC(CC(=O)CC(C)(c1ccccc1)S(=O)(=O)c1ccccc1)(c1ccccc1)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C31H30O5S2/c1-30(25-15-7-3-8-16-25,37(33,34)28-19-11-5-12-20-28)23-27(32)24-31(2,26-17-9-4-10-18-26)38(35,36)29-21-13-6-14-22-29/h3-22H,23-24H2,1-2H3 |
| InChIKey | PBANQWWMRZHFRU-UHFFFAOYSA-N |
| XLogP | 6.11 |
| TPSA | 85.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.71 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |