C24H26O5S — CID 57148231
2,6-dihydroxy-3,5-bis(2-phenylpropan-2-yl)benzenesulfonic acid (PubChem CID 57148231) has the molecular formula C24H26O5S and a molecular weight of 426.53 g/mol. Its IUPAC name is 2,6-dihydroxy-3,5-bis(2-phenylpropan-2-yl)benzenesulfonic acid.
| Compound Name | 2,6-dihydroxy-3,5-bis(2-phenylpropan-2-yl)benzenesulfonic acid |
|---|---|
| PubChem CID | 57148231 |
| Molecular Formula | C24H26O5S |
| Molecular Weight | 426.53 g/mol |
| Exact Mass | 426.15 |
| IUPAC Name | 2,6-dihydroxy-3,5-bis(2-phenylpropan-2-yl)benzenesulfonic acid |
| SMILES | CC(C)(c1ccccc1)c1cc(C(C)(C)c2ccccc2)c(O)c(S(=O)(=O)O)c1O |
| InChI | InChI=1S/C24H26O5S/c1-23(2,16-11-7-5-8-12-16)18-15-19(21(26)22(20(18)25)30(27,28)29)24(3,4)17-13-9-6-10-14-17/h5-15,25-26H,1-4H3,(H,27,28,29) |
| InChIKey | QDLBUXUFIONFQU-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 94.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.53 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|