C48H50O4S — CID 71427223
2-[2-hydroxy-3,5-bis(2-phenylpropan-2-yl)phenyl]sulfonyl-4,6-bis(2-phenylpropan-2-yl)phenol (PubChem CID 71427223) has the molecular formula C48H50O4S and a molecular weight of 722.99 g/mol. Its IUPAC name is 2-[2-hydroxy-3,5-bis(2-phenylpropan-2-yl)phenyl]sulfonyl-4,6-bis(2-phenylpropan-2-yl)phenol.
| Compound Name | 2-[2-hydroxy-3,5-bis(2-phenylpropan-2-yl)phenyl]sulfonyl-4,6-bis(2-phenylpropan-2-yl)phenol |
|---|---|
| PubChem CID | 71427223 |
| Molecular Formula | C48H50O4S |
| Molecular Weight | 722.99 g/mol |
| Exact Mass | 722.34 |
| IUPAC Name | 2-[2-hydroxy-3,5-bis(2-phenylpropan-2-yl)phenyl]sulfonyl-4,6-bis(2-phenylpropan-2-yl)phenol |
| SMILES | CC(C)(c1ccccc1)c1cc(C(C)(C)c2ccccc2)c(O)c(S(=O)(=O)c2cc(C(C)(C)c3ccccc3)cc(C(C)(C)c3ccccc3)c2O)c1 |
| InChI | InChI=1S/C48H50O4S/c1-45(2,33-21-13-9-14-22-33)37-29-39(47(5,6)35-25-17-11-18-26-35)43(49)41(31-37)53(51,52)42-32-38(46(3,4)34-23-15-10-16-24-34)30-40(44(42)50)48(7,8)36-27-19-12-20-28-36/h9-32,49-50H,1-8H3 |
| InChIKey | JDVLDGXEAIAGLL-UHFFFAOYSA-N |
| XLogP | 11.23 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 722.99 |
| LogP ≤ 5 | 11.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |