C30H37N3O — CID 145365952
2-amino-4,6-bis(2-phenylpropan-2-yl)phenol;cyclohexa-2,6-diene-1,2-diamine (PubChem CID 145365952) has the molecular formula C30H37N3O and a molecular weight of 455.65 g/mol. Its IUPAC name is 2-amino-4,6-bis(2-phenylpropan-2-yl)phenol;cyclohexa-2,6-diene-1,2-diamine.
| Compound Name | 2-amino-4,6-bis(2-phenylpropan-2-yl)phenol;cyclohexa-2,6-diene-1,2-diamine |
|---|---|
| PubChem CID | 145365952 |
| Molecular Formula | C30H37N3O |
| Molecular Weight | 455.65 g/mol |
| Exact Mass | 455.29 |
| IUPAC Name | 2-amino-4,6-bis(2-phenylpropan-2-yl)phenol;cyclohexa-2,6-diene-1,2-diamine |
| SMILES | CC(C)(c1ccccc1)c1cc(N)c(O)c(C(C)(C)c2ccccc2)c1.NC1=CCCC=C1N |
| InChI | InChI=1S/C24H27NO.C6H10N2/c1-23(2,17-11-7-5-8-12-17)19-15-20(22(26)21(25)16-19)24(3,4)18-13-9-6-10-14-18;7-5-3-1-2-4-6(5)8/h5-16,26H,25H2,1-4H3;3-4H,1-2,7-8H2 |
| InChIKey | QAOXYLYGWPQKMA-UHFFFAOYSA-N |
| XLogP | 6.09 |
| TPSA | 98.29 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.65 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|