C28H26F10N2O2 — CID 139946506
2-amino-4-[2-[3-[2-[3-amino-4-hydroxy-5-(1,1,2,2,2-pentafluoroethyl)phenyl]propan-2-yl]phenyl]propan-2-yl]-6-(1,1,2,2,2-pentafluoroethyl)phenol (PubChem CID 139946506) has the molecular formula C28H26F10N2O2 and a molecular weight of 612.51 g/mol. Its IUPAC name is 2-amino-4-[2-[3-[2-[3-amino-4-hydroxy-5-(1,1,2,2,2-pentafluoroethyl)phenyl]propan-2-yl]phenyl]propan-2-yl]-6-(1,1,2,2,2-pentafluoroethyl)phenol.
| Compound Name | 2-amino-4-[2-[3-[2-[3-amino-4-hydroxy-5-(1,1,2,2,2-pentafluoroethyl)phenyl]propan-2-yl]phenyl]propan-2-yl]-6-(1,1,2,2,2-pentafluoroethyl)phenol |
|---|---|
| PubChem CID | 139946506 |
| Molecular Formula | C28H26F10N2O2 |
| Molecular Weight | 612.51 g/mol |
| Exact Mass | 612.18 |
| IUPAC Name | 2-amino-4-[2-[3-[2-[3-amino-4-hydroxy-5-(1,1,2,2,2-pentafluoroethyl)phenyl]propan-2-yl]phenyl]propan-2-yl]-6-(1,1,2,2,2-pentafluoroethyl)phenol |
| SMILES | CC(C)(c1cccc(C(C)(C)c2cc(N)c(O)c(C(F)(F)C(F)(F)F)c2)c1)c1cc(N)c(O)c(C(F)(F)C(F)(F)F)c1 |
| InChI | InChI=1S/C28H26F10N2O2/c1-23(2,15-9-17(21(41)19(39)11-15)25(29,30)27(33,34)35)13-6-5-7-14(8-13)24(3,4)16-10-18(22(42)20(40)12-16)26(31,32)28(36,37)38/h5-12,41-42H,39-40H2,1-4H3 |
| InChIKey | LEKSUSQGMFCDRY-UHFFFAOYSA-N |
| XLogP | 8.22 |
| TPSA | 92.50 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 612.51 |
| LogP ≤ 5 | 8.22 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|