C11H6F11NO — CID 154087588
2-amino-4-(1,1,1,3,3,3-hexafluoropropan-2-yl)-6-(1,1,2,2,2-pentafluoroethyl)phenol (PubChem CID 154087588) has the molecular formula C11H6F11NO and a molecular weight of 377.15 g/mol. Its IUPAC name is 2-amino-4-(1,1,1,3,3,3-hexafluoropropan-2-yl)-6-(1,1,2,2,2-pentafluoroethyl)phenol.
| Compound Name | 2-amino-4-(1,1,1,3,3,3-hexafluoropropan-2-yl)-6-(1,1,2,2,2-pentafluoroethyl)phenol |
|---|---|
| PubChem CID | 154087588 |
| Molecular Formula | C11H6F11NO |
| Molecular Weight | 377.15 g/mol |
| Exact Mass | 377.03 |
| IUPAC Name | 2-amino-4-(1,1,1,3,3,3-hexafluoropropan-2-yl)-6-(1,1,2,2,2-pentafluoroethyl)phenol |
| SMILES | Nc1cc(C(C(F)(F)F)C(F)(F)F)cc(C(F)(F)C(F)(F)F)c1O |
| InChI | InChI=1S/C11H6F11NO/c12-8(13,11(20,21)22)4-1-3(2-5(23)6(4)24)7(9(14,15)16)10(17,18)19/h1-2,7,24H,23H2 |
| InChIKey | WVGNVMUIZMUTMS-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.15 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|