C11H4F12 — CID 139245768
1-(1,1,1,3,3,3-hexafluoropropan-2-yl)-3,5-bis(trifluoromethyl)benzene (PubChem CID 139245768) has the molecular formula C11H4F12 and a molecular weight of 364.13 g/mol. Its IUPAC name is 1-(1,1,1,3,3,3-hexafluoropropan-2-yl)-3,5-bis(trifluoromethyl)benzene.
| Compound Name | 1-(1,1,1,3,3,3-hexafluoropropan-2-yl)-3,5-bis(trifluoromethyl)benzene |
|---|---|
| PubChem CID | 139245768 |
| Molecular Formula | C11H4F12 |
| Molecular Weight | 364.13 g/mol |
| Exact Mass | 364.01 |
| IUPAC Name | 1-(1,1,1,3,3,3-hexafluoropropan-2-yl)-3,5-bis(trifluoromethyl)benzene |
| SMILES | FC(F)(F)c1cc(C(C(F)(F)F)C(F)(F)F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C11H4F12/c12-8(13,14)5-1-4(2-6(3-5)9(15,16)17)7(10(18,19)20)11(21,22)23/h1-3,7H |
| InChIKey | ZTAIYBVHQMFOTB-UHFFFAOYSA-N |
| XLogP | 5.93 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.13 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |