C18H11F12N — CID 143923962
(1S)-1,2-bis[3,5-bis(trifluoromethyl)phenyl]ethanamine (PubChem CID 143923962) has the molecular formula C18H11F12N and a molecular weight of 469.27 g/mol. Its IUPAC name is (1S)-1,2-bis[3,5-bis(trifluoromethyl)phenyl]ethanamine.
| Compound Name | (1S)-1,2-bis[3,5-bis(trifluoromethyl)phenyl]ethanamine |
|---|---|
| PubChem CID | 143923962 |
| Molecular Formula | C18H11F12N |
| Molecular Weight | 469.27 g/mol |
| Exact Mass | 469.07 |
| IUPAC Name | (1S)-1,2-bis[3,5-bis(trifluoromethyl)phenyl]ethanamine |
| SMILES | N[C@@H](Cc1cc(C(F)(F)F)cc(C(F)(F)F)c1)c1cc(C(F)(F)F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C18H11F12N/c19-15(20,21)10-1-8(2-11(6-10)16(22,23)24)3-14(31)9-4-12(17(25,26)27)7-13(5-9)18(28,29)30/h1-2,4-7,14H,3,31H2/t14-/m0/s1 |
| InChIKey | PEVLUPWUDIOAEJ-AWEZNQCLSA-N |
| XLogP | 7.00 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.27 |
| LogP ≤ 5 | 7.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |