C15H20F3NO3 — CID 90023853
ethyl 3-amino-3-[3-(2-hydroxypropyl)-5-(trifluoromethyl)phenyl]propanoate (PubChem CID 90023853) has the molecular formula C15H20F3NO3 and a molecular weight of 319.32 g/mol. Its IUPAC name is ethyl 3-amino-3-[3-(2-hydroxypropyl)-5-(trifluoromethyl)phenyl]propanoate.
| Compound Name | ethyl 3-amino-3-[3-(2-hydroxypropyl)-5-(trifluoromethyl)phenyl]propanoate |
|---|---|
| PubChem CID | 90023853 |
| Molecular Formula | C15H20F3NO3 |
| Molecular Weight | 319.32 g/mol |
| Exact Mass | 319.14 |
| IUPAC Name | ethyl 3-amino-3-[3-(2-hydroxypropyl)-5-(trifluoromethyl)phenyl]propanoate |
| SMILES | CCOC(=O)CC(N)c1cc(CC(C)O)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C15H20F3NO3/c1-3-22-14(21)8-13(19)11-5-10(4-9(2)20)6-12(7-11)15(16,17)18/h5-7,9,13,20H,3-4,8,19H2,1-2H3 |
| InChIKey | VNTYAXWUMIMRJQ-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 72.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.32 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |