C12H12ClF4NO2 — CID 171209232
ethyl (3R)-3-amino-3-[3-chloro-2-fluoro-5-(trifluoromethyl)phenyl]propanoate (PubChem CID 171209232) has the molecular formula C12H12ClF4NO2 and a molecular weight of 313.68 g/mol. Its IUPAC name is ethyl (3R)-3-amino-3-[3-chloro-2-fluoro-5-(trifluoromethyl)phenyl]propanoate.
| Compound Name | ethyl (3R)-3-amino-3-[3-chloro-2-fluoro-5-(trifluoromethyl)phenyl]propanoate |
|---|---|
| PubChem CID | 171209232 |
| Molecular Formula | C12H12ClF4NO2 |
| Molecular Weight | 313.68 g/mol |
| Exact Mass | 313.05 |
| IUPAC Name | ethyl (3R)-3-amino-3-[3-chloro-2-fluoro-5-(trifluoromethyl)phenyl]propanoate |
| SMILES | CCOC(=O)C[C@@H](N)c1cc(C(F)(F)F)cc(Cl)c1F |
| InChI | InChI=1S/C12H12ClF4NO2/c1-2-20-10(19)5-9(18)7-3-6(12(15,16)17)4-8(13)11(7)14/h3-4,9H,2,5,18H2,1H3/t9-/m1/s1 |
| InChIKey | FHYRNLHJQXOYOW-SECBINFHSA-N |
| XLogP | 3.45 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.68 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |