C9H8Cl2F5N — CID 171228766
(1R)-1-[3-chloro-2-fluoro-5-(trifluoromethyl)phenyl]-2-fluoroethanamine;hydrochloride (PubChem CID 171228766) has the molecular formula C9H8Cl2F5N and a molecular weight of 296.07 g/mol. Its IUPAC name is (1R)-1-[3-chloro-2-fluoro-5-(trifluoromethyl)phenyl]-2-fluoroethanamine;hydrochloride.
| Compound Name | (1R)-1-[3-chloro-2-fluoro-5-(trifluoromethyl)phenyl]-2-fluoroethanamine;hydrochloride |
|---|---|
| PubChem CID | 171228766 |
| Molecular Formula | C9H8Cl2F5N |
| Molecular Weight | 296.07 g/mol |
| Exact Mass | 295.00 |
| IUPAC Name | (1R)-1-[3-chloro-2-fluoro-5-(trifluoromethyl)phenyl]-2-fluoroethanamine;hydrochloride |
| SMILES | Cl.N[C@@H](CF)c1cc(C(F)(F)F)cc(Cl)c1F |
| InChI | InChI=1S/C9H7ClF5N.ClH/c10-6-2-4(9(13,14)15)1-5(8(6)12)7(16)3-11;/h1-2,7H,3,16H2;1H/t7-;/m0./s1 |
| InChIKey | RZGLTEKTIUSZSE-FJXQXJEOSA-N |
| XLogP | 3.89 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.07 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |