C13H17Cl2F4N — CID 171228785
(1S)-1-[3-chloro-2-fluoro-5-(trifluoromethyl)phenyl]hexan-1-amine;hydrochloride (PubChem CID 171228785) has the molecular formula C13H17Cl2F4N and a molecular weight of 334.18 g/mol. Its IUPAC name is (1S)-1-[3-chloro-2-fluoro-5-(trifluoromethyl)phenyl]hexan-1-amine;hydrochloride.
| Compound Name | (1S)-1-[3-chloro-2-fluoro-5-(trifluoromethyl)phenyl]hexan-1-amine;hydrochloride |
|---|---|
| PubChem CID | 171228785 |
| Molecular Formula | C13H17Cl2F4N |
| Molecular Weight | 334.18 g/mol |
| Exact Mass | 333.07 |
| IUPAC Name | (1S)-1-[3-chloro-2-fluoro-5-(trifluoromethyl)phenyl]hexan-1-amine;hydrochloride |
| SMILES | CCCCC[C@H](N)c1cc(C(F)(F)F)cc(Cl)c1F.Cl |
| InChI | InChI=1S/C13H16ClF4N.ClH/c1-2-3-4-5-11(19)9-6-8(13(16,17)18)7-10(14)12(9)15;/h6-7,11H,2-5,19H2,1H3;1H/t11-;/m0./s1 |
| InChIKey | MJLGTNJFRLTAHA-MERQFXBCSA-N |
| XLogP | 5.50 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.18 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|