C12H16Cl2F4N2 — CID 171209187
(1R)-1-[3-chloro-2-fluoro-5-(trifluoromethyl)phenyl]pentane-1,5-diamine;hydrochloride (PubChem CID 171209187) has the molecular formula C12H16Cl2F4N2 and a molecular weight of 335.17 g/mol. Its IUPAC name is (1R)-1-[3-chloro-2-fluoro-5-(trifluoromethyl)phenyl]pentane-1,5-diamine;hydrochloride.
| Compound Name | (1R)-1-[3-chloro-2-fluoro-5-(trifluoromethyl)phenyl]pentane-1,5-diamine;hydrochloride |
|---|---|
| PubChem CID | 171209187 |
| Molecular Formula | C12H16Cl2F4N2 |
| Molecular Weight | 335.17 g/mol |
| Exact Mass | 334.06 |
| IUPAC Name | (1R)-1-[3-chloro-2-fluoro-5-(trifluoromethyl)phenyl]pentane-1,5-diamine;hydrochloride |
| SMILES | Cl.NCCCC[C@@H](N)c1cc(C(F)(F)F)cc(Cl)c1F |
| InChI | InChI=1S/C12H15ClF4N2.ClH/c13-9-6-7(12(15,16)17)5-8(11(9)14)10(19)3-1-2-4-18;/h5-6,10H,1-4,18-19H2;1H/t10-;/m1./s1 |
| InChIKey | PKSVPNYUYLLZKW-HNCPQSOCSA-N |
| XLogP | 4.05 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.17 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|