C13H15Cl2F4NO — CID 171242729
(S)-[3-chloro-2-fluoro-5-(trifluoromethyl)phenyl]-(oxan-4-yl)methanamine;hydrochloride (PubChem CID 171242729) has the molecular formula C13H15Cl2F4NO and a molecular weight of 348.17 g/mol. Its IUPAC name is (S)-[3-chloro-2-fluoro-5-(trifluoromethyl)phenyl]-(oxan-4-yl)methanamine;hydrochloride.
| Compound Name | (S)-[3-chloro-2-fluoro-5-(trifluoromethyl)phenyl]-(oxan-4-yl)methanamine;hydrochloride |
|---|---|
| PubChem CID | 171242729 |
| Molecular Formula | C13H15Cl2F4NO |
| Molecular Weight | 348.17 g/mol |
| Exact Mass | 347.05 |
| IUPAC Name | (S)-[3-chloro-2-fluoro-5-(trifluoromethyl)phenyl]-(oxan-4-yl)methanamine;hydrochloride |
| SMILES | Cl.N[C@H](c1cc(C(F)(F)F)cc(Cl)c1F)C1CCOCC1 |
| InChI | InChI=1S/C13H14ClF4NO.ClH/c14-10-6-8(13(16,17)18)5-9(11(10)15)12(19)7-1-3-20-4-2-7;/h5-7,12H,1-4,19H2;1H/t12-;/m0./s1 |
| InChIKey | KQHBEEGQOATQHZ-YDALLXLXSA-N |
| XLogP | 4.35 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.17 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |