C14H19ClF3NO2 — CID 171245200
(S)-[2-methoxy-4-(trifluoromethyl)phenyl]-(oxan-4-yl)methanamine;hydrochloride (PubChem CID 171245200) has the molecular formula C14H19ClF3NO2 and a molecular weight of 325.76 g/mol. Its IUPAC name is (S)-[2-methoxy-4-(trifluoromethyl)phenyl]-(oxan-4-yl)methanamine;hydrochloride.
| Compound Name | (S)-[2-methoxy-4-(trifluoromethyl)phenyl]-(oxan-4-yl)methanamine;hydrochloride |
|---|---|
| PubChem CID | 171245200 |
| Molecular Formula | C14H19ClF3NO2 |
| Molecular Weight | 325.76 g/mol |
| Exact Mass | 325.11 |
| IUPAC Name | (S)-[2-methoxy-4-(trifluoromethyl)phenyl]-(oxan-4-yl)methanamine;hydrochloride |
| SMILES | COc1cc(C(F)(F)F)ccc1[C@@H](N)C1CCOCC1.Cl |
| InChI | InChI=1S/C14H18F3NO2.ClH/c1-19-12-8-10(14(15,16)17)2-3-11(12)13(18)9-4-6-20-7-5-9;/h2-3,8-9,13H,4-7,18H2,1H3;1H/t13-;/m0./s1 |
| InChIKey | IKKXXQVGADSPCT-ZOWNYOTGSA-N |
| XLogP | 3.56 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.76 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |