C14H22ClNO3 — CID 171246686
(R)-(2,4-dimethoxyphenyl)-(oxan-4-yl)methanamine;hydrochloride (PubChem CID 171246686) has the molecular formula C14H22ClNO3 and a molecular weight of 287.79 g/mol. Its IUPAC name is (R)-(2,4-dimethoxyphenyl)-(oxan-4-yl)methanamine;hydrochloride.
| Compound Name | (R)-(2,4-dimethoxyphenyl)-(oxan-4-yl)methanamine;hydrochloride |
|---|---|
| PubChem CID | 171246686 |
| Molecular Formula | C14H22ClNO3 |
| Molecular Weight | 287.79 g/mol |
| Exact Mass | 287.13 |
| IUPAC Name | (R)-(2,4-dimethoxyphenyl)-(oxan-4-yl)methanamine;hydrochloride |
| SMILES | COc1ccc([C@H](N)C2CCOCC2)c(OC)c1.Cl |
| InChI | InChI=1S/C14H21NO3.ClH/c1-16-11-3-4-12(13(9-11)17-2)14(15)10-5-7-18-8-6-10;/h3-4,9-10,14H,5-8,15H2,1-2H3;1H/t14-;/m1./s1 |
| InChIKey | XBGKSGONLNNSAU-PFEQFJNWSA-N |
| XLogP | 2.55 |
| TPSA | 53.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.79 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |