About 2-amino-3-[3,5-bis(trifluoromethyl)phenyl]propan-1-ol
2-amino-3-[3,5-bis(trifluoromethyl)phenyl]propan-1-ol (PubChem CID 87789027) has the molecular formula C11H11F6NO
and a molecular weight of 287.20 g/mol. Its IUPAC name is 2-amino-3-[3,5-bis(trifluoromethyl)phenyl]propan-1-ol.
Molecular Properties
| Compound Name | 2-amino-3-[3,5-bis(trifluoromethyl)phenyl]propan-1-ol |
| PubChem CID | 87789027 |
| Molecular Formula | C11H11F6NO |
| Molecular Weight | 287.20 g/mol |
| Exact Mass | 287.07 |
| IUPAC Name | 2-amino-3-[3,5-bis(trifluoromethyl)phenyl]propan-1-ol |
| SMILES | NC(CO)Cc1cc(C(F)(F)F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C11H11F6NO/c12-10(13,14)7-1-6(3-9(18)5-19)2-8(4-7)11(15,16)17/h1-2,4,9,19H,3,5,18H2 |
| InChIKey | LCQGMGDJIJMPNK-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 287.20 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-amino-3-[3,5-bis(trifluoromethyl)phenyl]propan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-3-[3,5-bis(trifluoromethyl)phenyl]propan-1-ol?
The IUPAC name of 2-amino-3-[3,5-bis(trifluoromethyl)phenyl]propan-1-ol (CID 87789027) is 2-amino-3-[3,5-bis(trifluoromethyl)phenyl]propan-1-ol.
What is the SMILES notation for 2-amino-3-[3,5-bis(trifluoromethyl)phenyl]propan-1-ol?
The canonical SMILES for 2-amino-3-[3,5-bis(trifluoromethyl)phenyl]propan-1-ol is NC(CO)Cc1cc(C(F)(F)F)cc(C(F)(F)F)c1.
What is the InChIKey of 2-amino-3-[3,5-bis(trifluoromethyl)phenyl]propan-1-ol?
The InChIKey is LCQGMGDJIJMPNK-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H11F6NO/c12-10(13,14)7-1-6(3-9(18)5-19)2-8(4-7)11(15,16)17/h1-2,4,9,19H,3,5,18H2.
What are the key properties of 2-amino-3-[3,5-bis(trifluoromethyl)phenyl]propan-1-ol?
2-amino-3-[3,5-bis(trifluoromethyl)phenyl]propan-1-ol has a molecular weight of 287.20 g/mol, XLogP of 2.59, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-3-[3,5-bis(trifluoromethyl)phenyl]propan-1-ol is sourced from PubChem (CID 87789027), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).