C9H14ClNO4 — CID 170891858
5-(2-amino-3-hydroxypropyl)benzene-1,2,3-triol;hydrochloride (PubChem CID 170891858) has the molecular formula C9H14ClNO4 and a molecular weight of 235.67 g/mol. Its IUPAC name is 5-(2-amino-3-hydroxypropyl)benzene-1,2,3-triol;hydrochloride.
| Compound Name | 5-(2-amino-3-hydroxypropyl)benzene-1,2,3-triol;hydrochloride |
|---|---|
| PubChem CID | 170891858 |
| Molecular Formula | C9H14ClNO4 |
| Molecular Weight | 235.67 g/mol |
| Exact Mass | 235.06 |
| IUPAC Name | 5-(2-amino-3-hydroxypropyl)benzene-1,2,3-triol;hydrochloride |
| SMILES | Cl.NC(CO)Cc1cc(O)c(O)c(O)c1 |
| InChI | InChI=1S/C9H13NO4.ClH/c10-6(4-11)1-5-2-7(12)9(14)8(13)3-5;/h2-3,6,11-14H,1,4,10H2;1H |
| InChIKey | BAYORWXGYWXFBS-UHFFFAOYSA-N |
| XLogP | 0.09 |
| TPSA | 106.94 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.67 |
| LogP ≤ 5 | 0.09 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|