C10H14INO3 — CID 170891887
4-(2-amino-3-hydroxypropyl)-2-iodo-6-methoxyphenol (PubChem CID 170891887) has the molecular formula C10H14INO3 and a molecular weight of 323.13 g/mol. Its IUPAC name is 4-(2-amino-3-hydroxypropyl)-2-iodo-6-methoxyphenol.
| Compound Name | 4-(2-amino-3-hydroxypropyl)-2-iodo-6-methoxyphenol |
|---|---|
| PubChem CID | 170891887 |
| Molecular Formula | C10H14INO3 |
| Molecular Weight | 323.13 g/mol |
| Exact Mass | 323.00 |
| IUPAC Name | 4-(2-amino-3-hydroxypropyl)-2-iodo-6-methoxyphenol |
| SMILES | COc1cc(CC(N)CO)cc(I)c1O |
| InChI | InChI=1S/C10H14INO3/c1-15-9-4-6(2-7(12)5-13)3-8(11)10(9)14/h3-4,7,13-14H,2,5,12H2,1H3 |
| InChIKey | JIKAFBOFOSVHSL-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.13 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|