C13H20ClNO3 — CID 170893167
2-(2-amino-3-hydroxypropyl)-6-methoxy-4-prop-2-enylphenol;hydrochloride (PubChem CID 170893167) has the molecular formula C13H20ClNO3 and a molecular weight of 273.76 g/mol. Its IUPAC name is 2-(2-amino-3-hydroxypropyl)-6-methoxy-4-prop-2-enylphenol;hydrochloride.
| Compound Name | 2-(2-amino-3-hydroxypropyl)-6-methoxy-4-prop-2-enylphenol;hydrochloride |
|---|---|
| PubChem CID | 170893167 |
| Molecular Formula | C13H20ClNO3 |
| Molecular Weight | 273.76 g/mol |
| Exact Mass | 273.11 |
| IUPAC Name | 2-(2-amino-3-hydroxypropyl)-6-methoxy-4-prop-2-enylphenol;hydrochloride |
| SMILES | C=CCc1cc(CC(N)CO)c(O)c(OC)c1.Cl |
| InChI | InChI=1S/C13H19NO3.ClH/c1-3-4-9-5-10(7-11(14)8-15)13(16)12(6-9)17-2;/h3,5-6,11,15-16H,1,4,7-8,14H2,2H3;1H |
| InChIKey | NDKRBDKZXGWFNR-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.76 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|