C23H31FN2O3+2 — CID 9317037
2-[[4-[(3-fluoro-4-methoxyphenyl)methyl]piperazine-1,4-diium-1-yl]methyl]-6-methoxy-4-prop-2-enylphenol (PubChem CID 9317037) has the molecular formula C23H31FN2O3+2 and a molecular weight of 402.51 g/mol. Its IUPAC name is 2-[[4-[(3-fluoro-4-methoxyphenyl)methyl]piperazine-1,4-diium-1-yl]methyl]-6-methoxy-4-prop-2-enylphenol.
| Compound Name | 2-[[4-[(3-fluoro-4-methoxyphenyl)methyl]piperazine-1,4-diium-1-yl]methyl]-6-methoxy-4-prop-2-enylphenol |
|---|---|
| PubChem CID | 9317037 |
| Molecular Formula | C23H31FN2O3+2 |
| Molecular Weight | 402.51 g/mol |
| Exact Mass | 402.23 |
| IUPAC Name | 2-[[4-[(3-fluoro-4-methoxyphenyl)methyl]piperazine-1,4-diium-1-yl]methyl]-6-methoxy-4-prop-2-enylphenol |
| SMILES | C=CCc1cc(C[NH+]2CC[NH+](Cc3ccc(OC)c(F)c3)CC2)c(O)c(OC)c1 |
| InChI | InChI=1S/C23H29FN2O3/c1-4-5-17-12-19(23(27)22(14-17)29-3)16-26-10-8-25(9-11-26)15-18-6-7-21(28-2)20(24)13-18/h4,6-7,12-14,27H,1,5,8-11,15-16H2,2-3H3/p+2 |
| InChIKey | INKOWKRUGBIHQE-UHFFFAOYSA-P |
| XLogP | 0.76 |
| TPSA | 47.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.51 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|