C21H26ClN2O2+ — CID 2573931
2-[[4-(3-chlorophenyl)piperazin-1-ium-1-yl]methyl]-6-methoxy-4-prop-2-enylphenol (PubChem CID 2573931) has the molecular formula C21H26ClN2O2+ and a molecular weight of 373.90 g/mol. Its IUPAC name is 2-[[4-(3-chlorophenyl)piperazin-1-ium-1-yl]methyl]-6-methoxy-4-prop-2-enylphenol.
| Compound Name | 2-[[4-(3-chlorophenyl)piperazin-1-ium-1-yl]methyl]-6-methoxy-4-prop-2-enylphenol |
|---|---|
| PubChem CID | 2573931 |
| Molecular Formula | C21H26ClN2O2+ |
| Molecular Weight | 373.90 g/mol |
| Exact Mass | 373.17 |
| IUPAC Name | 2-[[4-(3-chlorophenyl)piperazin-1-ium-1-yl]methyl]-6-methoxy-4-prop-2-enylphenol |
| SMILES | C=CCc1cc(C[NH+]2CCN(c3cccc(Cl)c3)CC2)c(O)c(OC)c1 |
| InChI | InChI=1S/C21H25ClN2O2/c1-3-5-16-12-17(21(25)20(13-16)26-2)15-23-8-10-24(11-9-23)19-7-4-6-18(22)14-19/h3-4,6-7,12-14,25H,1,5,8-11,15H2,2H3/p+1 |
| InChIKey | SCMCPARLYGLGKZ-UHFFFAOYSA-O |
| XLogP | 2.69 |
| TPSA | 37.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.90 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|