C20H24ClN2O2+ — CID 8530457
1-[3-[[4-(3-chlorophenyl)piperazin-1-ium-1-yl]methyl]-4-methoxyphenyl]ethanone (PubChem CID 8530457) has the molecular formula C20H24ClN2O2+ and a molecular weight of 359.88 g/mol. Its IUPAC name is 1-[3-[[4-(3-chlorophenyl)piperazin-1-ium-1-yl]methyl]-4-methoxyphenyl]ethanone.
| Compound Name | 1-[3-[[4-(3-chlorophenyl)piperazin-1-ium-1-yl]methyl]-4-methoxyphenyl]ethanone |
|---|---|
| PubChem CID | 8530457 |
| Molecular Formula | C20H24ClN2O2+ |
| Molecular Weight | 359.88 g/mol |
| Exact Mass | 359.15 |
| IUPAC Name | 1-[3-[[4-(3-chlorophenyl)piperazin-1-ium-1-yl]methyl]-4-methoxyphenyl]ethanone |
| SMILES | COc1ccc(C(C)=O)cc1C[NH+]1CCN(c2cccc(Cl)c2)CC1 |
| InChI | InChI=1S/C20H23ClN2O2/c1-15(24)16-6-7-20(25-2)17(12-16)14-22-8-10-23(11-9-22)19-5-3-4-18(21)13-19/h3-7,12-13H,8-11,14H2,1-2H3/p+1 |
| InChIKey | FYUQQGGAWXFCTH-UHFFFAOYSA-O |
| XLogP | 2.46 |
| TPSA | 33.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.88 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |