C22H24O8Zn — CID 175804048
bis(2-hydroxy-3-methoxy-5-prop-2-enylbenzoic acid);zinc (PubChem CID 175804048) has the molecular formula C22H24O8Zn and a molecular weight of 481.82 g/mol. Its IUPAC name is bis(2-hydroxy-3-methoxy-5-prop-2-enylbenzoic acid);zinc.
| Compound Name | bis(2-hydroxy-3-methoxy-5-prop-2-enylbenzoic acid);zinc |
|---|---|
| PubChem CID | 175804048 |
| Molecular Formula | C22H24O8Zn |
| Molecular Weight | 481.82 g/mol |
| Exact Mass | 480.08 |
| IUPAC Name | bis(2-hydroxy-3-methoxy-5-prop-2-enylbenzoic acid);zinc |
| SMILES | C=CCc1cc(OC)c(O)c(C(=O)O)c1.C=CCc1cc(OC)c(O)c(C(=O)O)c1.[Zn] |
| InChI | InChI=1S/2C11H12O4.Zn/c2*1-3-4-7-5-8(11(13)14)10(12)9(6-7)15-2;/h2*3,5-6,12H,1,4H2,2H3,(H,13,14); |
| InChIKey | MKGIXZMUIMCRKX-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 133.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.82 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|