C23H30N2O3 — CID 25342863
2-methoxy-6-[[methyl-[(4-morpholin-4-ylphenyl)methyl]amino]methyl]-4-prop-2-enylphenol (PubChem CID 25342863) has the molecular formula C23H30N2O3 and a molecular weight of 382.50 g/mol. Its IUPAC name is 2-methoxy-6-[[methyl-[(4-morpholin-4-ylphenyl)methyl]amino]methyl]-4-prop-2-enylphenol.
| Compound Name | 2-methoxy-6-[[methyl-[(4-morpholin-4-ylphenyl)methyl]amino]methyl]-4-prop-2-enylphenol |
|---|---|
| PubChem CID | 25342863 |
| Molecular Formula | C23H30N2O3 |
| Molecular Weight | 382.50 g/mol |
| Exact Mass | 382.23 |
| IUPAC Name | 2-methoxy-6-[[methyl-[(4-morpholin-4-ylphenyl)methyl]amino]methyl]-4-prop-2-enylphenol |
| SMILES | C=CCc1cc(CN(C)Cc2ccc(N3CCOCC3)cc2)c(O)c(OC)c1 |
| InChI | InChI=1S/C23H30N2O3/c1-4-5-19-14-20(23(26)22(15-19)27-3)17-24(2)16-18-6-8-21(9-7-18)25-10-12-28-13-11-25/h4,6-9,14-15,26H,1,5,10-13,16-17H2,2-3H3 |
| InChIKey | YGBKECBMWVTGOK-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 45.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.50 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|