C21H26N2O4 — CID 110612863
N-(3,4-dimethoxyphenyl)-N-methyl-2-(4-morpholin-4-ylphenyl)acetamide (PubChem CID 110612863) has the molecular formula C21H26N2O4 and a molecular weight of 370.45 g/mol. Its IUPAC name is N-(3,4-dimethoxyphenyl)-N-methyl-2-(4-morpholin-4-ylphenyl)acetamide.
| Compound Name | N-(3,4-dimethoxyphenyl)-N-methyl-2-(4-morpholin-4-ylphenyl)acetamide |
|---|---|
| PubChem CID | 110612863 |
| Molecular Formula | C21H26N2O4 |
| Molecular Weight | 370.45 g/mol |
| Exact Mass | 370.19 |
| IUPAC Name | N-(3,4-dimethoxyphenyl)-N-methyl-2-(4-morpholin-4-ylphenyl)acetamide |
| SMILES | COc1ccc(N(C)C(=O)Cc2ccc(N3CCOCC3)cc2)cc1OC |
| InChI | InChI=1S/C21H26N2O4/c1-22(18-8-9-19(25-2)20(15-18)26-3)21(24)14-16-4-6-17(7-5-16)23-10-12-27-13-11-23/h4-9,15H,10-14H2,1-3H3 |
| InChIKey | PBOVIZLAQQLQPA-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 51.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.45 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|