C22H28N2O4S — CID 99951185
(2S)-2-(3,4-dimethoxyphenyl)sulfanyl-N-[(4-morpholin-4-ylphenyl)methyl]propanamide (PubChem CID 99951185) has the molecular formula C22H28N2O4S and a molecular weight of 416.54 g/mol. Its IUPAC name is (2S)-2-(3,4-dimethoxyphenyl)sulfanyl-N-[(4-morpholin-4-ylphenyl)methyl]propanamide.
| Compound Name | (2S)-2-(3,4-dimethoxyphenyl)sulfanyl-N-[(4-morpholin-4-ylphenyl)methyl]propanamide |
|---|---|
| PubChem CID | 99951185 |
| Molecular Formula | C22H28N2O4S |
| Molecular Weight | 416.54 g/mol |
| Exact Mass | 416.18 |
| IUPAC Name | (2S)-2-(3,4-dimethoxyphenyl)sulfanyl-N-[(4-morpholin-4-ylphenyl)methyl]propanamide |
| SMILES | COc1ccc(S[C@@H](C)C(=O)NCc2ccc(N3CCOCC3)cc2)cc1OC |
| InChI | InChI=1S/C22H28N2O4S/c1-16(29-19-8-9-20(26-2)21(14-19)27-3)22(25)23-15-17-4-6-18(7-5-17)24-10-12-28-13-11-24/h4-9,14,16H,10-13,15H2,1-3H3,(H,23,25)/t16-/m0/s1 |
| InChIKey | WTCOGVWVSXSZRB-INIZCTEOSA-N |
| XLogP | 3.34 |
| TPSA | 60.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.54 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|