C15H21NO4S — CID 43885604
2-(3,4-dimethoxyphenyl)sulfanyl-1-morpholin-4-ylpropan-1-one (PubChem CID 43885604) has the molecular formula C15H21NO4S and a molecular weight of 311.40 g/mol. Its IUPAC name is 2-(3,4-dimethoxyphenyl)sulfanyl-1-morpholin-4-ylpropan-1-one.
| Compound Name | 2-(3,4-dimethoxyphenyl)sulfanyl-1-morpholin-4-ylpropan-1-one |
|---|---|
| PubChem CID | 43885604 |
| Molecular Formula | C15H21NO4S |
| Molecular Weight | 311.40 g/mol |
| Exact Mass | 311.12 |
| IUPAC Name | 2-(3,4-dimethoxyphenyl)sulfanyl-1-morpholin-4-ylpropan-1-one |
| SMILES | COc1ccc(SC(C)C(=O)N2CCOCC2)cc1OC |
| InChI | InChI=1S/C15H21NO4S/c1-11(15(17)16-6-8-20-9-7-16)21-12-4-5-13(18-2)14(10-12)19-3/h4-5,10-11H,6-9H2,1-3H3 |
| InChIKey | AMYRQWDBSXXGFE-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.40 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |