C14H19NO3S — CID 28632965
(2S)-2-(4-methoxyphenyl)sulfanyl-1-morpholin-4-ylpropan-1-one (PubChem CID 28632965) has the molecular formula C14H19NO3S and a molecular weight of 281.38 g/mol. Its IUPAC name is (2S)-2-(4-methoxyphenyl)sulfanyl-1-morpholin-4-ylpropan-1-one.
| Compound Name | (2S)-2-(4-methoxyphenyl)sulfanyl-1-morpholin-4-ylpropan-1-one |
|---|---|
| PubChem CID | 28632965 |
| Molecular Formula | C14H19NO3S |
| Molecular Weight | 281.38 g/mol |
| Exact Mass | 281.11 |
| IUPAC Name | (2S)-2-(4-methoxyphenyl)sulfanyl-1-morpholin-4-ylpropan-1-one |
| SMILES | COc1ccc(S[C@@H](C)C(=O)N2CCOCC2)cc1 |
| InChI | InChI=1S/C14H19NO3S/c1-11(14(16)15-7-9-18-10-8-15)19-13-5-3-12(17-2)4-6-13/h3-6,11H,7-10H2,1-2H3/t11-/m0/s1 |
| InChIKey | ISCARFZRXMJLDO-NSHDSACASA-N |
| XLogP | 2.03 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.38 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |