C22H26N2O4 — CID 110316227
2-(3,4-dimethoxyphenyl)-1-(5-morpholin-4-yl-2,3-dihydroindol-1-yl)ethanone (PubChem CID 110316227) has the molecular formula C22H26N2O4 and a molecular weight of 382.46 g/mol. Its IUPAC name is 2-(3,4-dimethoxyphenyl)-1-(5-morpholin-4-yl-2,3-dihydroindol-1-yl)ethanone.
| Compound Name | 2-(3,4-dimethoxyphenyl)-1-(5-morpholin-4-yl-2,3-dihydroindol-1-yl)ethanone |
|---|---|
| PubChem CID | 110316227 |
| Molecular Formula | C22H26N2O4 |
| Molecular Weight | 382.46 g/mol |
| Exact Mass | 382.19 |
| IUPAC Name | 2-(3,4-dimethoxyphenyl)-1-(5-morpholin-4-yl-2,3-dihydroindol-1-yl)ethanone |
| SMILES | COc1ccc(CC(=O)N2CCc3cc(N4CCOCC4)ccc32)cc1OC |
| InChI | InChI=1S/C22H26N2O4/c1-26-20-6-3-16(13-21(20)27-2)14-22(25)24-8-7-17-15-18(4-5-19(17)24)23-9-11-28-12-10-23/h3-6,13,15H,7-12,14H2,1-2H3 |
| InChIKey | NCXKAJDNHXSIMK-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 51.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.46 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|