C22H26N2O2 — CID 110316014
3-(4-methoxyphenyl)-1-(5-pyrrolidin-1-yl-2,3-dihydroindol-1-yl)propan-1-one (PubChem CID 110316014) has the molecular formula C22H26N2O2 and a molecular weight of 350.46 g/mol. Its IUPAC name is 3-(4-methoxyphenyl)-1-(5-pyrrolidin-1-yl-2,3-dihydroindol-1-yl)propan-1-one.
| Compound Name | 3-(4-methoxyphenyl)-1-(5-pyrrolidin-1-yl-2,3-dihydroindol-1-yl)propan-1-one |
|---|---|
| PubChem CID | 110316014 |
| Molecular Formula | C22H26N2O2 |
| Molecular Weight | 350.46 g/mol |
| Exact Mass | 350.20 |
| IUPAC Name | 3-(4-methoxyphenyl)-1-(5-pyrrolidin-1-yl-2,3-dihydroindol-1-yl)propan-1-one |
| SMILES | COc1ccc(CCC(=O)N2CCc3cc(N4CCCC4)ccc32)cc1 |
| InChI | InChI=1S/C22H26N2O2/c1-26-20-8-4-17(5-9-20)6-11-22(25)24-15-12-18-16-19(7-10-21(18)24)23-13-2-3-14-23/h4-5,7-10,16H,2-3,6,11-15H2,1H3 |
| InChIKey | XDEBHOBYTGHEAU-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.46 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|