C24H25N3O2 — CID 110355057
3-[3-oxo-3-(5-pyrrolidin-1-yl-2,3-dihydroindol-1-yl)propyl]-1H-quinolin-2-one (PubChem CID 110355057) has the molecular formula C24H25N3O2 and a molecular weight of 387.48 g/mol. Its IUPAC name is 3-[3-oxo-3-(5-pyrrolidin-1-yl-2,3-dihydroindol-1-yl)propyl]-1H-quinolin-2-one.
| Compound Name | 3-[3-oxo-3-(5-pyrrolidin-1-yl-2,3-dihydroindol-1-yl)propyl]-1H-quinolin-2-one |
|---|---|
| PubChem CID | 110355057 |
| Molecular Formula | C24H25N3O2 |
| Molecular Weight | 387.48 g/mol |
| Exact Mass | 387.19 |
| IUPAC Name | 3-[3-oxo-3-(5-pyrrolidin-1-yl-2,3-dihydroindol-1-yl)propyl]-1H-quinolin-2-one |
| SMILES | O=C(CCc1cc2ccccc2[nH]c1=O)N1CCc2cc(N3CCCC3)ccc21 |
| InChI | InChI=1S/C24H25N3O2/c28-23(10-7-19-15-17-5-1-2-6-21(17)25-24(19)29)27-14-11-18-16-20(8-9-22(18)27)26-12-3-4-13-26/h1-2,5-6,8-9,15-16H,3-4,7,10-14H2,(H,25,29) |
| InChIKey | UQKINPFGKZENTH-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 56.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.48 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|