C21H23FN2O2 — CID 110634561
3-(3-fluorophenyl)-1-(5-morpholin-4-yl-2,3-dihydroindol-1-yl)propan-1-one (PubChem CID 110634561) has the molecular formula C21H23FN2O2 and a molecular weight of 354.43 g/mol. Its IUPAC name is 3-(3-fluorophenyl)-1-(5-morpholin-4-yl-2,3-dihydroindol-1-yl)propan-1-one.
| Compound Name | 3-(3-fluorophenyl)-1-(5-morpholin-4-yl-2,3-dihydroindol-1-yl)propan-1-one |
|---|---|
| PubChem CID | 110634561 |
| Molecular Formula | C21H23FN2O2 |
| Molecular Weight | 354.43 g/mol |
| Exact Mass | 354.17 |
| IUPAC Name | 3-(3-fluorophenyl)-1-(5-morpholin-4-yl-2,3-dihydroindol-1-yl)propan-1-one |
| SMILES | O=C(CCc1cccc(F)c1)N1CCc2cc(N3CCOCC3)ccc21 |
| InChI | InChI=1S/C21H23FN2O2/c22-18-3-1-2-16(14-18)4-7-21(25)24-9-8-17-15-19(5-6-20(17)24)23-10-12-26-13-11-23/h1-3,5-6,14-15H,4,7-13H2 |
| InChIKey | TYERBRXZPTZWGC-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.43 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|